C9H5BrClNO2S — CID 53413026
methyl 6-bromo-2-chloro-1,3-benzothiazole-4-carboxylate (PubChem CID 53413026) has the molecular formula C9H5BrClNO2S and a molecular weight of 306.57 g/mol. Its IUPAC name is methyl 6-bromo-2-chloro-1,3-benzothiazole-4-carboxylate.
| Compound Name | methyl 6-bromo-2-chloro-1,3-benzothiazole-4-carboxylate |
|---|---|
| PubChem CID | 53413026 |
| Molecular Formula | C9H5BrClNO2S |
| Molecular Weight | 306.57 g/mol |
| Exact Mass | 304.89 |
| IUPAC Name | methyl 6-bromo-2-chloro-1,3-benzothiazole-4-carboxylate |
| SMILES | COC(=O)c1cc(Br)cc2sc(Cl)nc12 |
| InChI | InChI=1S/C9H5BrClNO2S/c1-14-8(13)5-2-4(10)3-6-7(5)12-9(11)15-6/h2-3H,1H3 |
| InChIKey | CXOKUPPASJEAQR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |