C11H14Cl2N2O2S — CID 53415405
1-[(2,5-dichlorophenyl)methylsulfonyl]piperazine (PubChem CID 53415405) has the molecular formula C11H14Cl2N2O2S and a molecular weight of 309.22 g/mol. Its IUPAC name is 1-[(2,5-dichlorophenyl)methylsulfonyl]piperazine.
| Compound Name | 1-[(2,5-dichlorophenyl)methylsulfonyl]piperazine |
|---|---|
| PubChem CID | 53415405 |
| Molecular Formula | C11H14Cl2N2O2S |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 1-[(2,5-dichlorophenyl)methylsulfonyl]piperazine |
| SMILES | O=S(=O)(Cc1cc(Cl)ccc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C11H14Cl2N2O2S/c12-10-1-2-11(13)9(7-10)8-18(16,17)15-5-3-14-4-6-15/h1-2,7,14H,3-6,8H2 |
| InChIKey | CKVULWKXHSESCY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |