C15H18Cl2N2O2S — CID 75438945
1-[1-[(2,4-dichlorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole (PubChem CID 75438945) has the molecular formula C15H18Cl2N2O2S and a molecular weight of 361.29 g/mol. Its IUPAC name is 1-[1-[(2,4-dichlorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole.
| Compound Name | 1-[1-[(2,4-dichlorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 75438945 |
| Molecular Formula | C15H18Cl2N2O2S |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 1-[1-[(2,4-dichlorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole |
| SMILES | O=S(=O)(Cc1ccc(Cl)cc1Cl)N1CCC(N2CC=CC2)C1 |
| InChI | InChI=1S/C15H18Cl2N2O2S/c16-13-4-3-12(15(17)9-13)11-22(20,21)19-8-5-14(10-19)18-6-1-2-7-18/h1-4,9,14H,5-8,10-11H2 |
| InChIKey | FGTJDXOSKWJVHC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|