C17H15F2N3 — CID 53416526
1-benzyl-3-(2,5-difluorophenyl)-4-methylpyrazol-5-amine (PubChem CID 53416526) has the molecular formula C17H15F2N3 and a molecular weight of 299.32 g/mol. Its IUPAC name is 1-benzyl-3-(2,5-difluorophenyl)-4-methylpyrazol-5-amine.
| Compound Name | 1-benzyl-3-(2,5-difluorophenyl)-4-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 53416526 |
| Molecular Formula | C17H15F2N3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-benzyl-3-(2,5-difluorophenyl)-4-methylpyrazol-5-amine |
| SMILES | Cc1c(-c2cc(F)ccc2F)nn(Cc2ccccc2)c1N |
| InChI | InChI=1S/C17H15F2N3/c1-11-16(14-9-13(18)7-8-15(14)19)21-22(17(11)20)10-12-5-3-2-4-6-12/h2-9H,10,20H2,1H3 |
| InChIKey | FYHNYDAYRWXIQQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |