C20H28ClN3O2 — CID 53422323
1-[bis(prop-2-enyl)amino]-3-[(6-methoxyquinolin-8-yl)amino]-2-methylpropan-2-ol;hydrochloride (PubChem CID 53422323) has the molecular formula C20H28ClN3O2 and a molecular weight of 377.92 g/mol. Its IUPAC name is 1-[bis(prop-2-enyl)amino]-3-[(6-methoxyquinolin-8-yl)amino]-2-methylpropan-2-ol;hydrochloride.
| Compound Name | 1-[bis(prop-2-enyl)amino]-3-[(6-methoxyquinolin-8-yl)amino]-2-methylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 53422323 |
| Molecular Formula | C20H28ClN3O2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-[bis(prop-2-enyl)amino]-3-[(6-methoxyquinolin-8-yl)amino]-2-methylpropan-2-ol;hydrochloride |
| SMILES | C=CCN(CC=C)CC(C)(O)CNc1cc(OC)cc2cccnc12.Cl |
| InChI | InChI=1S/C20H27N3O2.ClH/c1-5-10-23(11-6-2)15-20(3,24)14-22-18-13-17(25-4)12-16-8-7-9-21-19(16)18;/h5-9,12-13,22,24H,1-2,10-11,14-15H2,3-4H3;1H |
| InChIKey | BWYZFHIBRJQYOZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|