C19H29Cl2N3O2 — CID 76844980
1-[(6-methoxyquinolin-8-yl)amino]-2-methyl-3-piperidin-1-ylpropan-2-ol;dihydrochloride (PubChem CID 76844980) has the molecular formula C19H29Cl2N3O2 and a molecular weight of 402.37 g/mol. Its IUPAC name is 1-[(6-methoxyquinolin-8-yl)amino]-2-methyl-3-piperidin-1-ylpropan-2-ol;dihydrochloride.
| Compound Name | 1-[(6-methoxyquinolin-8-yl)amino]-2-methyl-3-piperidin-1-ylpropan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 76844980 |
| Molecular Formula | C19H29Cl2N3O2 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 1-[(6-methoxyquinolin-8-yl)amino]-2-methyl-3-piperidin-1-ylpropan-2-ol;dihydrochloride |
| SMILES | COc1cc(NCC(C)(O)CN2CCCCC2)c2ncccc2c1.Cl.Cl |
| InChI | InChI=1S/C19H27N3O2.2ClH/c1-19(23,14-22-9-4-3-5-10-22)13-21-17-12-16(24-2)11-15-7-6-8-20-18(15)17;;/h6-8,11-12,21,23H,3-5,9-10,13-14H2,1-2H3;2*1H |
| InChIKey | LNDOITUCTBHTAW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |