C19H22ClN2O6S- — CID 53425202
3-[4-[(3-chlorophenyl)methoxy]phenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one;methanesulfonate (PubChem CID 53425202) has the molecular formula C19H22ClN2O6S- and a molecular weight of 441.91 g/mol. Its IUPAC name is 3-[4-[(3-chlorophenyl)methoxy]phenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one;methanesulfonate.
| Compound Name | 3-[4-[(3-chlorophenyl)methoxy]phenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one;methanesulfonate |
|---|---|
| PubChem CID | 53425202 |
| Molecular Formula | C19H22ClN2O6S- |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 3-[4-[(3-chlorophenyl)methoxy]phenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one;methanesulfonate |
| SMILES | CNCC1CN(c2ccc(OCc3cccc(Cl)c3)cc2)C(=O)O1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C18H19ClN2O3.CH4O3S/c1-20-10-17-11-21(18(22)24-17)15-5-7-16(8-6-15)23-12-13-3-2-4-14(19)9-13;1-5(2,3)4/h2-9,17,20H,10-12H2,1H3;1H3,(H,2,3,4)/p-1 |
| InChIKey | WQWXUPMCRORTRU-UHFFFAOYSA-M |
| XLogP | 2.62 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|