C23H22FN3O3 — CID 53431762
N'-(2-fluorophenyl)-N'-[(2-propoxynaphthalen-1-yl)methylideneamino]propanediamide (PubChem CID 53431762) has the molecular formula C23H22FN3O3 and a molecular weight of 407.45 g/mol. Its IUPAC name is N'-(2-fluorophenyl)-N'-[(2-propoxynaphthalen-1-yl)methylideneamino]propanediamide.
| Compound Name | N'-(2-fluorophenyl)-N'-[(2-propoxynaphthalen-1-yl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 53431762 |
| Molecular Formula | C23H22FN3O3 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N'-(2-fluorophenyl)-N'-[(2-propoxynaphthalen-1-yl)methylideneamino]propanediamide |
| SMILES | CCCOc1ccc2ccccc2c1C=NN(C(=O)CC(N)=O)c1ccccc1F |
| InChI | InChI=1S/C23H22FN3O3/c1-2-13-30-21-12-11-16-7-3-4-8-17(16)18(21)15-26-27(23(29)14-22(25)28)20-10-6-5-9-19(20)24/h3-12,15H,2,13-14H2,1H3,(H2,25,28) |
| InChIKey | FNAHRZPSJANDNI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|