C16H22Cl2N2O3 — CID 53437182
N',N'-bis(2-chloroethyl)-3-(4-methoxyphenyl)pentanediamide (PubChem CID 53437182) has the molecular formula C16H22Cl2N2O3 and a molecular weight of 361.27 g/mol. Its IUPAC name is N',N'-bis(2-chloroethyl)-3-(4-methoxyphenyl)pentanediamide.
| Compound Name | N',N'-bis(2-chloroethyl)-3-(4-methoxyphenyl)pentanediamide |
|---|---|
| PubChem CID | 53437182 |
| Molecular Formula | C16H22Cl2N2O3 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N',N'-bis(2-chloroethyl)-3-(4-methoxyphenyl)pentanediamide |
| SMILES | COc1ccc(C(CC(N)=O)CC(=O)N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C16H22Cl2N2O3/c1-23-14-4-2-12(3-5-14)13(10-15(19)21)11-16(22)20(8-6-17)9-7-18/h2-5,13H,6-11H2,1H3,(H2,19,21) |
| InChIKey | ONBKFXMPWKSHAB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|