C14H22ClN3O4 — CID 119956088
2-amino-N-[2-(4-methoxyphenoxy)ethyl]-N-methylbutanediamide;hydrochloride (PubChem CID 119956088) has the molecular formula C14H22ClN3O4 and a molecular weight of 331.80 g/mol. Its IUPAC name is 2-amino-N-[2-(4-methoxyphenoxy)ethyl]-N-methylbutanediamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(4-methoxyphenoxy)ethyl]-N-methylbutanediamide;hydrochloride |
|---|---|
| PubChem CID | 119956088 |
| Molecular Formula | C14H22ClN3O4 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-amino-N-[2-(4-methoxyphenoxy)ethyl]-N-methylbutanediamide;hydrochloride |
| SMILES | COc1ccc(OCCN(C)C(=O)C(N)CC(N)=O)cc1.Cl |
| InChI | InChI=1S/C14H21N3O4.ClH/c1-17(14(19)12(15)9-13(16)18)7-8-21-11-5-3-10(20-2)4-6-11;/h3-6,12H,7-9,15H2,1-2H3,(H2,16,18);1H |
| InChIKey | UCGVQBRAVXRDRE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |