C16H16ClN3O5S — CID 53441851
3-[(4-carbamoylphenyl)carbamoylamino]-4-ethoxybenzenesulfonyl chloride (PubChem CID 53441851) has the molecular formula C16H16ClN3O5S and a molecular weight of 397.84 g/mol. Its IUPAC name is 3-[(4-carbamoylphenyl)carbamoylamino]-4-ethoxybenzenesulfonyl chloride.
| Compound Name | 3-[(4-carbamoylphenyl)carbamoylamino]-4-ethoxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 53441851 |
| Molecular Formula | C16H16ClN3O5S |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 3-[(4-carbamoylphenyl)carbamoylamino]-4-ethoxybenzenesulfonyl chloride |
| SMILES | CCOc1ccc(S(=O)(=O)Cl)cc1NC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C16H16ClN3O5S/c1-2-25-14-8-7-12(26(17,23)24)9-13(14)20-16(22)19-11-5-3-10(4-6-11)15(18)21/h3-9H,2H2,1H3,(H2,18,21)(H2,19,20,22) |
| InChIKey | ADOMHWYFZLKIRI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |