C22H18N4OS — CID 5344227
4-methyl-N-[(Z)-2-naphthalen-1-yl-1-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)ethenyl]benzamide (PubChem CID 5344227) has the molecular formula C22H18N4OS and a molecular weight of 386.48 g/mol. Its IUPAC name is 4-methyl-N-[(Z)-2-naphthalen-1-yl-1-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)ethenyl]benzamide.
| Compound Name | 4-methyl-N-[(Z)-2-naphthalen-1-yl-1-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)ethenyl]benzamide |
|---|---|
| PubChem CID | 5344227 |
| Molecular Formula | C22H18N4OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 4-methyl-N-[(Z)-2-naphthalen-1-yl-1-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)ethenyl]benzamide |
| SMILES | Cc1ccc(C(=O)N/C(=C\c2cccc3ccccc23)c2nc(=S)[nH][nH]2)cc1 |
| InChI | InChI=1S/C22H18N4OS/c1-14-9-11-16(12-10-14)21(27)23-19(20-24-22(28)26-25-20)13-17-7-4-6-15-5-2-3-8-18(15)17/h2-13H,1H3,(H,23,27)(H2,24,25,26,28)/b19-13- |
| InChIKey | QEDAVDYMBQTDOU-UYRXBGFRSA-N |
| XLogP | 4.86 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|