C28H24Cl2NOP — CID 13225603
N-[(E)-2-chloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-4-methylbenzamide (PubChem CID 13225603) has the molecular formula C28H24Cl2NOP and a molecular weight of 492.39 g/mol. Its IUPAC name is N-[(E)-2-chloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-4-methylbenzamide.
| Compound Name | N-[(E)-2-chloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 13225603 |
| Molecular Formula | C28H24Cl2NOP |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | N-[(E)-2-chloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/C(=C\Cl)P(Cl)(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24Cl2NOP/c1-22-17-19-23(20-18-22)28(32)31-27(21-29)33(30,24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-21H,1H3,(H,31,32)/b27-21+ |
| InChIKey | ZBISEJVISQXZKF-SZXQPVLSSA-N |
| XLogP | 6.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|