C9H11ClFN2O2PS — CID 53443232
1-(3-chloro-4-fluorophenyl)-3-[ethyl(hydroxy)phosphinothioyl]urea (PubChem CID 53443232) has the molecular formula C9H11ClFN2O2PS and a molecular weight of 296.69 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[ethyl(hydroxy)phosphinothioyl]urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[ethyl(hydroxy)phosphinothioyl]urea |
|---|---|
| PubChem CID | 53443232 |
| Molecular Formula | C9H11ClFN2O2PS |
| Molecular Weight | 296.69 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[ethyl(hydroxy)phosphinothioyl]urea |
| SMILES | CCP(O)(=S)NC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C9H11ClFN2O2PS/c1-2-16(15,17)13-9(14)12-6-3-4-8(11)7(10)5-6/h3-5H,2H2,1H3,(H3,12,13,14,15,17) |
| InChIKey | XHDDFIBWLWZIJX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.69 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|