C19H19Cl2NO — CID 53446248
N-(2,4-dichloro-6-methylphenyl)-N-(1-phenylcyclopentyl)formamide (PubChem CID 53446248) has the molecular formula C19H19Cl2NO and a molecular weight of 348.27 g/mol. Its IUPAC name is N-(2,4-dichloro-6-methylphenyl)-N-(1-phenylcyclopentyl)formamide.
| Compound Name | N-(2,4-dichloro-6-methylphenyl)-N-(1-phenylcyclopentyl)formamide |
|---|---|
| PubChem CID | 53446248 |
| Molecular Formula | C19H19Cl2NO |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-(2,4-dichloro-6-methylphenyl)-N-(1-phenylcyclopentyl)formamide |
| SMILES | Cc1cc(Cl)cc(Cl)c1N(C=O)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C19H19Cl2NO/c1-14-11-16(20)12-17(21)18(14)22(13-23)19(9-5-6-10-19)15-7-3-2-4-8-15/h2-4,7-8,11-13H,5-6,9-10H2,1H3 |
| InChIKey | DLXBRGMZFSWNLA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|