C25H33NaO7 — CID 53463926
sodium 4-[2-(11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoate (PubChem CID 53463926) has the molecular formula C25H33NaO7 and a molecular weight of 468.52 g/mol. Its IUPAC name is sodium 4-[2-(11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoate.
| Compound Name | sodium 4-[2-(11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoate |
|---|---|
| PubChem CID | 53463926 |
| Molecular Formula | C25H33NaO7 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | sodium 4-[2-(11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoate |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C(C(=O)COC(=O)CCC(=O)[O-])CCC12.[Na+] |
| InChI | InChI=1S/C25H34O7.Na/c1-24-10-9-15(26)11-14(24)3-4-16-17-5-6-18(25(17,2)12-19(27)23(16)24)20(28)13-32-22(31)8-7-21(29)30;/h11,16-19,23,27H,3-10,12-13H2,1-2H3,(H,29,30);/q;+1/p-1 |
| InChIKey | ZVGAMAIUOZXIOQ-UHFFFAOYSA-M |
| XLogP | -1.25 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |