C27H38N2O11 — CID 143936629
[2-(11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 5,6-dinitrooxyhexanoate (PubChem CID 143936629) has the molecular formula C27H38N2O11 and a molecular weight of 566.60 g/mol. Its IUPAC name is [2-(11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 5,6-dinitrooxyhexanoate.
| Compound Name | [2-(11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 5,6-dinitrooxyhexanoate |
|---|---|
| PubChem CID | 143936629 |
| Molecular Formula | C27H38N2O11 |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | [2-(11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 5,6-dinitrooxyhexanoate |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C(C(=O)COC(=O)CCCC(CO[N+](=O)[O-])O[N+](=O)[O-])CCC12 |
| InChI | InChI=1S/C27H38N2O11/c1-26-11-10-17(30)12-16(26)6-7-19-20-8-9-21(27(20,2)13-22(31)25(19)26)23(32)15-38-24(33)5-3-4-18(40-29(36)37)14-39-28(34)35/h12,18-22,25,31H,3-11,13-15H2,1-2H3 |
| InChIKey | NWHHMQRIRDLZSR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 185.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|