C30H44N2O9 — CID 143731175
[2-(11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 3-(6-nitrooxyhexanoylamino)propanoate (PubChem CID 143731175) has the molecular formula C30H44N2O9 and a molecular weight of 576.69 g/mol. Its IUPAC name is [2-(11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 3-(6-nitrooxyhexanoylamino)propanoate.
| Compound Name | [2-(11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 3-(6-nitrooxyhexanoylamino)propanoate |
|---|---|
| PubChem CID | 143731175 |
| Molecular Formula | C30H44N2O9 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | [2-(11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 3-(6-nitrooxyhexanoylamino)propanoate |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C(C(=O)COC(=O)CCNC(=O)CCCCCO[N+](=O)[O-])CCC12 |
| InChI | InChI=1S/C30H44N2O9/c1-29-13-11-20(33)16-19(29)7-8-21-22-9-10-23(30(22,2)17-24(34)28(21)29)25(35)18-40-27(37)12-14-31-26(36)6-4-3-5-15-41-32(38)39/h16,21-24,28,34H,3-15,17-18H2,1-2H3,(H,31,36) |
| InChIKey | DTZNRQYKTGWETB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|