C29H23NO2 — CID 53466602
(2E)-2-[(E,1S)-1,3-diphenylprop-2-enoxy]imino-1,2-diphenylethanone (PubChem CID 53466602) has the molecular formula C29H23NO2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (2E)-2-[(E,1S)-1,3-diphenylprop-2-enoxy]imino-1,2-diphenylethanone.
| Compound Name | (2E)-2-[(E,1S)-1,3-diphenylprop-2-enoxy]imino-1,2-diphenylethanone |
|---|---|
| PubChem CID | 53466602 |
| Molecular Formula | C29H23NO2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (2E)-2-[(E,1S)-1,3-diphenylprop-2-enoxy]imino-1,2-diphenylethanone |
| SMILES | O=C(/C(=N/O[C@@H](/C=C/c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H23NO2/c31-29(26-19-11-4-12-20-26)28(25-17-9-3-10-18-25)30-32-27(24-15-7-2-8-16-24)22-21-23-13-5-1-6-14-23/h1-22,27H/b22-21+,30-28+/t27-/m0/s1 |
| InChIKey | ALLROTRPLUSUNQ-KKQBBYBCSA-N |
| XLogP | 6.74 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|