C18H13F3O3 — CID 53467055
(3-benzyl-2H-chromen-4-yl) 2,2,2-trifluoroacetate (PubChem CID 53467055) has the molecular formula C18H13F3O3 and a molecular weight of 334.29 g/mol. Its IUPAC name is (3-benzyl-2H-chromen-4-yl) 2,2,2-trifluoroacetate.
| Compound Name | (3-benzyl-2H-chromen-4-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 53467055 |
| Molecular Formula | C18H13F3O3 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (3-benzyl-2H-chromen-4-yl) 2,2,2-trifluoroacetate |
| SMILES | O=C(OC1=C(Cc2ccccc2)COc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C18H13F3O3/c19-18(20,21)17(22)24-16-13(10-12-6-2-1-3-7-12)11-23-15-9-5-4-8-14(15)16/h1-9H,10-11H2 |
| InChIKey | SPQICORQJBTTCV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |