C16H20N2O3 — CID 53468563
5-[[2-(methylamino)benzoyl]amino]pentyl prop-2-ynoate (PubChem CID 53468563) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-[[2-(methylamino)benzoyl]amino]pentyl prop-2-ynoate.
| Compound Name | 5-[[2-(methylamino)benzoyl]amino]pentyl prop-2-ynoate |
|---|---|
| PubChem CID | 53468563 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 5-[[2-(methylamino)benzoyl]amino]pentyl prop-2-ynoate |
| SMILES | C#CC(=O)OCCCCCNC(=O)c1ccccc1NC |
| InChI | InChI=1S/C16H20N2O3/c1-3-15(19)21-12-8-4-7-11-18-16(20)13-9-5-6-10-14(13)17-2/h1,5-6,9-10,17H,4,7-8,11-12H2,2H3,(H,18,20) |
| InChIKey | BSOVGAXDXNHAGN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|