C27H28ClFN4O2 — CID 53476478
tert-butyl 8-chloro-1-[(1S)-4-(4-fluorophenyl)cyclohex-3-en-1-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate (PubChem CID 53476478) has the molecular formula C27H28ClFN4O2 and a molecular weight of 495.00 g/mol. Its IUPAC name is tert-butyl 8-chloro-1-[(1S)-4-(4-fluorophenyl)cyclohex-3-en-1-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate.
| Compound Name | tert-butyl 8-chloro-1-[(1S)-4-(4-fluorophenyl)cyclohex-3-en-1-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 53476478 |
| Molecular Formula | C27H28ClFN4O2 |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | tert-butyl 8-chloro-1-[(1S)-4-(4-fluorophenyl)cyclohex-3-en-1-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2cc(Cl)ccc2-n2c(nnc2[C@@H]2CC=C(c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C27H28ClFN4O2/c1-27(2,3)35-26(34)32-15-20-14-21(28)10-13-23(20)33-24(16-32)30-31-25(33)19-6-4-17(5-7-19)18-8-11-22(29)12-9-18/h4,8-14,19H,5-7,15-16H2,1-3H3/t19-/m1/s1 |
| InChIKey | JQQKDMXNEUWPMO-LJQANCHMSA-N |
| XLogP | 6.66 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |