C26H30ClN5O3 — CID 46235353
tert-butyl 8-chloro-1-(4-pyridin-3-yloxycyclohexyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate (PubChem CID 46235353) has the molecular formula C26H30ClN5O3 and a molecular weight of 496.01 g/mol. Its IUPAC name is tert-butyl 8-chloro-1-(4-pyridin-3-yloxycyclohexyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate.
| Compound Name | tert-butyl 8-chloro-1-(4-pyridin-3-yloxycyclohexyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 46235353 |
| Molecular Formula | C26H30ClN5O3 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | tert-butyl 8-chloro-1-(4-pyridin-3-yloxycyclohexyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2cc(Cl)ccc2-n2c(nnc2C2CCC(Oc3cccnc3)CC2)C1 |
| InChI | InChI=1S/C26H30ClN5O3/c1-26(2,3)35-25(33)31-15-18-13-19(27)8-11-22(18)32-23(16-31)29-30-24(32)17-6-9-20(10-7-17)34-21-5-4-12-28-14-21/h4-5,8,11-14,17,20H,6-7,9-10,15-16H2,1-3H3 |
| InChIKey | JHAQWACFHQBRTR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |