C19H23ClN4O3 — CID 67372772
8-chloro-1-(4-ethoxycyclohexyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylic acid (PubChem CID 67372772) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 8-chloro-1-(4-ethoxycyclohexyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylic acid.
| Compound Name | 8-chloro-1-(4-ethoxycyclohexyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylic acid |
|---|---|
| PubChem CID | 67372772 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 8-chloro-1-(4-ethoxycyclohexyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylic acid |
| SMILES | CCOC1CCC(c2nnc3n2-c2ccc(Cl)cc2CN(C(=O)O)C3)CC1 |
| InChI | InChI=1S/C19H23ClN4O3/c1-2-27-15-6-3-12(4-7-15)18-22-21-17-11-23(19(25)26)10-13-9-14(20)5-8-16(13)24(17)18/h5,8-9,12,15H,2-4,6-7,10-11H2,1H3,(H,25,26) |
| InChIKey | HVTZCWCSWGPGLJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |