C19H18BrN2O5P — CID 53483562
[4-(4-bromophenyl)-5-dimethoxyphosphoryl-1H-pyrazol-3-yl]-(4-methoxyphenyl)methanone (PubChem CID 53483562) has the molecular formula C19H18BrN2O5P and a molecular weight of 465.24 g/mol. Its IUPAC name is [4-(4-bromophenyl)-5-dimethoxyphosphoryl-1H-pyrazol-3-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [4-(4-bromophenyl)-5-dimethoxyphosphoryl-1H-pyrazol-3-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 53483562 |
| Molecular Formula | C19H18BrN2O5P |
| Molecular Weight | 465.24 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | [4-(4-bromophenyl)-5-dimethoxyphosphoryl-1H-pyrazol-3-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2n[nH]c(P(=O)(OC)OC)c2-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C19H18BrN2O5P/c1-25-15-10-6-13(7-11-15)18(23)17-16(12-4-8-14(20)9-5-12)19(22-21-17)28(24,26-2)27-3/h4-11H,1-3H3,(H,21,22) |
| InChIKey | ORIZZMSKSOKLRT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|