C18H14N2OS — CID 53486641
3-benzyl-8-methylpyrimido[2,1-b][1,3]benzothiazol-4-one (PubChem CID 53486641) has the molecular formula C18H14N2OS and a molecular weight of 306.39 g/mol. Its IUPAC name is 3-benzyl-8-methylpyrimido[2,1-b][1,3]benzothiazol-4-one.
| Compound Name | 3-benzyl-8-methylpyrimido[2,1-b][1,3]benzothiazol-4-one |
|---|---|
| PubChem CID | 53486641 |
| Molecular Formula | C18H14N2OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3-benzyl-8-methylpyrimido[2,1-b][1,3]benzothiazol-4-one |
| SMILES | Cc1ccc2c(c1)sc1ncc(Cc3ccccc3)c(=O)n12 |
| InChI | InChI=1S/C18H14N2OS/c1-12-7-8-15-16(9-12)22-18-19-11-14(17(21)20(15)18)10-13-5-3-2-4-6-13/h2-9,11H,10H2,1H3 |
| InChIKey | KFZJEZRLUCJUDX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |