C9H9ClF2N2O4 — CID 53487734
(3S)-3-amino-2,2-difluoro-3-(4-nitrophenyl)propanoic acid;hydrochloride (PubChem CID 53487734) has the molecular formula C9H9ClF2N2O4 and a molecular weight of 282.63 g/mol. Its IUPAC name is (3S)-3-amino-2,2-difluoro-3-(4-nitrophenyl)propanoic acid;hydrochloride.
| Compound Name | (3S)-3-amino-2,2-difluoro-3-(4-nitrophenyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 53487734 |
| Molecular Formula | C9H9ClF2N2O4 |
| Molecular Weight | 282.63 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | (3S)-3-amino-2,2-difluoro-3-(4-nitrophenyl)propanoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc([N+](=O)[O-])cc1)C(F)(F)C(=O)O |
| InChI | InChI=1S/C9H8F2N2O4.ClH/c10-9(11,8(14)15)7(12)5-1-3-6(4-2-5)13(16)17;/h1-4,7H,12H2,(H,14,15);1H/t7-;/m0./s1 |
| InChIKey | SNLFTJRLKIZHCB-FJXQXJEOSA-N |
| XLogP | 1.74 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.63 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|