C21H27FN4OS — CID 53488605
N-[2-(diethylamino)ethyl]-4-[(4-fluoro-3-methylphenyl)carbamothioylamino]benzamide (PubChem CID 53488605) has the molecular formula C21H27FN4OS and a molecular weight of 402.54 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-[(4-fluoro-3-methylphenyl)carbamothioylamino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-[(4-fluoro-3-methylphenyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 53488605 |
| Molecular Formula | C21H27FN4OS |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-[(4-fluoro-3-methylphenyl)carbamothioylamino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=S)Nc2ccc(F)c(C)c2)cc1 |
| InChI | InChI=1S/C21H27FN4OS/c1-4-26(5-2)13-12-23-20(27)16-6-8-17(9-7-16)24-21(28)25-18-10-11-19(22)15(3)14-18/h6-11,14H,4-5,12-13H2,1-3H3,(H,23,27)(H2,24,25,28) |
| InChIKey | NQXQIFBQSFJLOM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|