C20H24ClFN4OS — CID 21008701
4-[(3-chloro-4-fluorophenyl)carbamothioylamino]-N-[2-(diethylamino)ethyl]benzamide (PubChem CID 21008701) has the molecular formula C20H24ClFN4OS and a molecular weight of 422.96 g/mol. Its IUPAC name is 4-[(3-chloro-4-fluorophenyl)carbamothioylamino]-N-[2-(diethylamino)ethyl]benzamide.
| Compound Name | 4-[(3-chloro-4-fluorophenyl)carbamothioylamino]-N-[2-(diethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 21008701 |
| Molecular Formula | C20H24ClFN4OS |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 4-[(3-chloro-4-fluorophenyl)carbamothioylamino]-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=S)Nc2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H24ClFN4OS/c1-3-26(4-2)12-11-23-19(27)14-5-7-15(8-6-14)24-20(28)25-16-9-10-18(22)17(21)13-16/h5-10,13H,3-4,11-12H2,1-2H3,(H,23,27)(H2,24,25,28) |
| InChIKey | UHIFLYJCOXIUFB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|