C33H36N4O4 — CID 53491370
(2S)-2-[[5-[5-[[6-[[(1S)-2-hydroxy-1-phenylethyl]iminomethyl]-3-pyridinyl]oxy]pentoxy]-2-pyridinyl]methylideneamino]-2-phenylethanol (PubChem CID 53491370) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is (2S)-2-[[5-[5-[[6-[[(1S)-2-hydroxy-1-phenylethyl]iminomethyl]-3-pyridinyl]oxy]pentoxy]-2-pyridinyl]methylideneamino]-2-phenylethanol.
| Compound Name | (2S)-2-[[5-[5-[[6-[[(1S)-2-hydroxy-1-phenylethyl]iminomethyl]-3-pyridinyl]oxy]pentoxy]-2-pyridinyl]methylideneamino]-2-phenylethanol |
|---|---|
| PubChem CID | 53491370 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | (2S)-2-[[5-[5-[[6-[[(1S)-2-hydroxy-1-phenylethyl]iminomethyl]-3-pyridinyl]oxy]pentoxy]-2-pyridinyl]methylideneamino]-2-phenylethanol |
| SMILES | OC[C@@H](/N=C/c1ccc(OCCCCCOc2ccc(/C=N/[C@H](CO)c3ccccc3)nc2)cn1)c1ccccc1 |
| InChI | InChI=1S/C33H36N4O4/c38-24-32(26-10-4-1-5-11-26)36-20-28-14-16-30(22-34-28)40-18-8-3-9-19-41-31-17-15-29(35-23-31)21-37-33(25-39)27-12-6-2-7-13-27/h1-2,4-7,10-17,20-23,32-33,38-39H,3,8-9,18-19,24-25H2/b36-20+,37-21+/t32-,33-/m1/s1 |
| InChIKey | KAMDJAOZMNTOGR-AISDRQQXSA-N |
| XLogP | 5.41 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|