C34H40N4O2 — CID 87527218
(1E,3Z)-5-[[(1S)-1-phenylethyl]iminomethyl]-2-[5-[[6-[[(1S)-1-phenylethyl]iminomethyl]-3-pyridinyl]oxy]pentoxy]hexa-1,3,5-trien-1-amine (PubChem CID 87527218) has the molecular formula C34H40N4O2 and a molecular weight of 536.72 g/mol. Its IUPAC name is (1E,3Z)-5-[[(1S)-1-phenylethyl]iminomethyl]-2-[5-[[6-[[(1S)-1-phenylethyl]iminomethyl]-3-pyridinyl]oxy]pentoxy]hexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z)-5-[[(1S)-1-phenylethyl]iminomethyl]-2-[5-[[6-[[(1S)-1-phenylethyl]iminomethyl]-3-pyridinyl]oxy]pentoxy]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 87527218 |
| Molecular Formula | C34H40N4O2 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | (1E,3Z)-5-[[(1S)-1-phenylethyl]iminomethyl]-2-[5-[[6-[[(1S)-1-phenylethyl]iminomethyl]-3-pyridinyl]oxy]pentoxy]hexa-1,3,5-trien-1-amine |
| SMILES | C=C(/C=C\C(=C/N)OCCCCCOc1ccc(/C=N/[C@@H](C)c2ccccc2)nc1)/C=N/[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C34H40N4O2/c1-27(24-36-28(2)30-13-7-4-8-14-30)17-19-33(23-35)39-21-11-6-12-22-40-34-20-18-32(38-26-34)25-37-29(3)31-15-9-5-10-16-31/h4-5,7-10,13-20,23-26,28-29H,1,6,11-12,21-22,35H2,2-3H3/b19-17-,33-23+,36-24+,37-25+/t28-,29-/m0/s1 |
| InChIKey | ITZKZJDKSQWPRS-MFCIDSHYSA-N |
| XLogP | 7.57 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|