C19H23N5O5 — CID 53491741
(3S,7R)-N-(3-imidazol-1-ylpropyl)-7-methyl-9,11,12-trioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradec-13-ene-13-carboxamide (PubChem CID 53491741) has the molecular formula C19H23N5O5 and a molecular weight of 401.42 g/mol. Its IUPAC name is (3S,7R)-N-(3-imidazol-1-ylpropyl)-7-methyl-9,11,12-trioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradec-13-ene-13-carboxamide.
| Compound Name | (3S,7R)-N-(3-imidazol-1-ylpropyl)-7-methyl-9,11,12-trioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradec-13-ene-13-carboxamide |
|---|---|
| PubChem CID | 53491741 |
| Molecular Formula | C19H23N5O5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | (3S,7R)-N-(3-imidazol-1-ylpropyl)-7-methyl-9,11,12-trioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradec-13-ene-13-carboxamide |
| SMILES | C[C@@H]1CCO[C@H]2CN3C=C(C(=O)NCCCn4ccnc4)C(=O)C(=O)C3C(=O)N12 |
| InChI | InChI=1S/C19H23N5O5/c1-12-3-8-29-14-10-23-9-13(16(25)17(26)15(23)19(28)24(12)14)18(27)21-4-2-6-22-7-5-20-11-22/h5,7,9,11-12,14-15H,2-4,6,8,10H2,1H3,(H,21,27)/t12-,14+,15?/m1/s1 |
| InChIKey | JFDUPDSEXDUTTJ-JEIKQXNFSA-N |
| XLogP | -0.93 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|