C21H19N3O5S — CID 155925155
(3R,6S)-N-(1-benzothiophen-5-ylmethyl)-6-methyl-8,10,11-trioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide (PubChem CID 155925155) has the molecular formula C21H19N3O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is (3R,6S)-N-(1-benzothiophen-5-ylmethyl)-6-methyl-8,10,11-trioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide.
| Compound Name | (3R,6S)-N-(1-benzothiophen-5-ylmethyl)-6-methyl-8,10,11-trioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide |
|---|---|
| PubChem CID | 155925155 |
| Molecular Formula | C21H19N3O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | (3R,6S)-N-(1-benzothiophen-5-ylmethyl)-6-methyl-8,10,11-trioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide |
| SMILES | C[C@H]1CO[C@@H]2CN3C=C(C(=O)NCc4ccc5sccc5c4)C(=O)C(=O)C3C(=O)N12 |
| InChI | InChI=1S/C21H19N3O5S/c1-11-10-29-16-9-23-8-14(18(25)19(26)17(23)21(28)24(11)16)20(27)22-7-12-2-3-15-13(6-12)4-5-30-15/h2-6,8,11,16-17H,7,9-10H2,1H3,(H,22,27)/t11-,16+,17?/m0/s1 |
| InChIKey | CMWMGIRXEBPCIW-QNQDRUDJSA-N |
| XLogP | 0.81 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|