C18H17ClN4O5 — CID 155925159
(3R,6S)-N-[(6-chloro-3-pyridinyl)methyl]-6-methyl-8,10,11-trioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide (PubChem CID 155925159) has the molecular formula C18H17ClN4O5 and a molecular weight of 404.81 g/mol. Its IUPAC name is (3R,6S)-N-[(6-chloro-3-pyridinyl)methyl]-6-methyl-8,10,11-trioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide.
| Compound Name | (3R,6S)-N-[(6-chloro-3-pyridinyl)methyl]-6-methyl-8,10,11-trioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide |
|---|---|
| PubChem CID | 155925159 |
| Molecular Formula | C18H17ClN4O5 |
| Molecular Weight | 404.81 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | (3R,6S)-N-[(6-chloro-3-pyridinyl)methyl]-6-methyl-8,10,11-trioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide |
| SMILES | C[C@H]1CO[C@@H]2CN3C=C(C(=O)NCc4ccc(Cl)nc4)C(=O)C(=O)C3C(=O)N12 |
| InChI | InChI=1S/C18H17ClN4O5/c1-9-8-28-13-7-22-6-11(15(24)16(25)14(22)18(27)23(9)13)17(26)21-5-10-2-3-12(19)20-4-10/h2-4,6,9,13-14H,5,7-8H2,1H3,(H,21,26)/t9-,13+,14?/m0/s1 |
| InChIKey | UNYKODDVRIDOGA-MHFOSTPTSA-N |
| XLogP | -0.36 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.81 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|