C22H16ClN3O2 — CID 53491838
2-amino-2'-(3-chlorophenyl)-3-methylspiro[imidazole-5,9'-xanthene]-4-one (PubChem CID 53491838) has the molecular formula C22H16ClN3O2 and a molecular weight of 389.84 g/mol. Its IUPAC name is 2-amino-2'-(3-chlorophenyl)-3-methylspiro[imidazole-5,9'-xanthene]-4-one.
| Compound Name | 2-amino-2'-(3-chlorophenyl)-3-methylspiro[imidazole-5,9'-xanthene]-4-one |
|---|---|
| PubChem CID | 53491838 |
| Molecular Formula | C22H16ClN3O2 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 2-amino-2'-(3-chlorophenyl)-3-methylspiro[imidazole-5,9'-xanthene]-4-one |
| SMILES | CN1C(=O)C2(N=C1N)c1ccccc1Oc1ccc(-c3cccc(Cl)c3)cc12 |
| InChI | InChI=1S/C22H16ClN3O2/c1-26-20(27)22(25-21(26)24)16-7-2-3-8-18(16)28-19-10-9-14(12-17(19)22)13-5-4-6-15(23)11-13/h2-12H,1H3,(H2,24,25) |
| InChIKey | ZTQKUXJNHZUDKN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |