C24H40ClNO3Si — CID 53494612
[(3aR,4S,8aS,8bS)-5-benzyl-2,2-dimethyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-5-ium-4-yl]methoxy-tert-butyl-dimethylsilane chloride (PubChem CID 53494612) has the molecular formula C24H40ClNO3Si and a molecular weight of 454.13 g/mol. Its IUPAC name is [(3aR,4S,8aS,8bS)-5-benzyl-2,2-dimethyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-5-ium-4-yl]methoxy-tert-butyl-dimethylsilane chloride.
| Compound Name | [(3aR,4S,8aS,8bS)-5-benzyl-2,2-dimethyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-5-ium-4-yl]methoxy-tert-butyl-dimethylsilane chloride |
|---|---|
| PubChem CID | 53494612 |
| Molecular Formula | C24H40ClNO3Si |
| Molecular Weight | 454.13 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | [(3aR,4S,8aS,8bS)-5-benzyl-2,2-dimethyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-5-ium-4-yl]methoxy-tert-butyl-dimethylsilane chloride |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](CO[Si](C)(C)C(C)(C)C)[N+]1(Cc3ccccc3)CCC[C@@H]21.[Cl-] |
| InChI | InChI=1S/C24H40NO3Si.ClH/c1-23(2,3)29(6,7)26-17-20-22-21(27-24(4,5)28-22)19-14-11-15-25(19,20)16-18-12-9-8-10-13-18;/h8-10,12-13,19-22H,11,14-17H2,1-7H3;1H/q+1;/p-1/t19-,20-,21-,22+,25?;/m0./s1 |
| InChIKey | FMPXDVQCBBXIRZ-OXWJNHTBSA-M |
| XLogP | 2.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.13 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|