About 1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate
1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate (PubChem CID 53494622) has the molecular formula C15H20O5S
and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate |
| PubChem CID | 53494622 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate |
| SMILES | CCOC(=O)/C(=C/Cc1ccsc1)CC(=O)OCCOC |
| InChI | InChI=1S/C15H20O5S/c1-3-19-15(17)13(5-4-12-6-9-21-11-12)10-14(16)20-8-7-18-2/h5-6,9,11H,3-4,7-8,10H2,1-2H3/b13-5+ |
| InChIKey | VJHWHYZGZDXVLK-WLRTZDKTSA-N |
| XLogP | 2.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate?
The IUPAC name of 1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate (CID 53494622) is 1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate.
What is the SMILES notation for 1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate?
The canonical SMILES for 1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate is CCOC(=O)/C(=C/Cc1ccsc1)CC(=O)OCCOC.
What is the InChIKey of 1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate?
The InChIKey is VJHWHYZGZDXVLK-WLRTZDKTSA-N. The full InChI is InChI=1S/C15H20O5S/c1-3-19-15(17)13(5-4-12-6-9-21-11-12)10-14(16)20-8-7-18-2/h5-6,9,11H,3-4,7-8,10H2,1-2H3/b13-5+.
What are the key properties of 1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate?
1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate has a molecular weight of 312.39 g/mol, XLogP of 2.36, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 4-O-(2-methoxyethyl) (2E)-2-(2-thiophen-3-ylethylidene)butanedioate is sourced from PubChem (CID 53494622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).