About 8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one
8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one (PubChem CID 53495488) has the molecular formula C26H19N3O2
and a molecular weight of 405.46 g/mol. Its IUPAC name is 8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one.
Molecular Properties
| Compound Name | 8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one |
| PubChem CID | 53495488 |
| Molecular Formula | C26H19N3O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one |
| SMILES | COc1cccc(-c2c3n(-c4ccccc4)nc(-c4ccccc4)nc-3ccc2=O)c1 |
| InChI | InChI=1S/C26H19N3O2/c1-31-21-14-8-11-19(17-21)24-23(30)16-15-22-25(24)29(20-12-6-3-7-13-20)28-26(27-22)18-9-4-2-5-10-18/h2-17H,1H3 |
| InChIKey | QVHZKPQUIKXORE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one?
The IUPAC name of 8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one (CID 53495488) is 8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one.
What is the SMILES notation for 8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one?
The canonical SMILES for 8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one is COc1cccc(-c2c3n(-c4ccccc4)nc(-c4ccccc4)nc-3ccc2=O)c1.
What is the InChIKey of 8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one?
The InChIKey is QVHZKPQUIKXORE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19N3O2/c1-31-21-14-8-11-19(17-21)24-23(30)16-15-22-25(24)29(20-12-6-3-7-13-20)28-26(27-22)18-9-4-2-5-10-18/h2-17H,1H3.
What are the key properties of 8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one?
8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one has a molecular weight of 405.46 g/mol, XLogP of 5.07, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-methoxyphenyl)-1,3-diphenyl-1,2,4-benzotriazin-7-one is sourced from PubChem (CID 53495488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).