About 3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide
3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide (PubChem CID 53496351) has the molecular formula C23H23FN4O3
and a molecular weight of 422.46 g/mol. Its IUPAC name is 3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide.
Molecular Properties
| Compound Name | 3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide |
| PubChem CID | 53496351 |
| Molecular Formula | C23H23FN4O3 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide |
| SMILES | NC(=O)c1cccc(-c2ccc(NCC(CC3OCCO3)c3ccccc3F)nn2)c1 |
| InChI | InChI=1S/C23H23FN4O3/c24-19-7-2-1-6-18(19)17(13-22-30-10-11-31-22)14-26-21-9-8-20(27-28-21)15-4-3-5-16(12-15)23(25)29/h1-9,12,17,22H,10-11,13-14H2,(H2,25,29)(H,26,28) |
| InChIKey | FKUILWNJICKYQL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide?
The IUPAC name of 3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide (CID 53496351) is 3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide.
What is the SMILES notation for 3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide?
The canonical SMILES for 3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide is NC(=O)c1cccc(-c2ccc(NCC(CC3OCCO3)c3ccccc3F)nn2)c1.
What is the InChIKey of 3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide?
The InChIKey is FKUILWNJICKYQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN4O3/c24-19-7-2-1-6-18(19)17(13-22-30-10-11-31-22)14-26-21-9-8-20(27-28-21)15-4-3-5-16(12-15)23(25)29/h1-9,12,17,22H,10-11,13-14H2,(H2,25,29)(H,26,28).
What are the key properties of 3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide?
3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide has a molecular weight of 422.46 g/mol, XLogP of 3.34, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-[[3-(1,3-dioxolan-2-yl)-2-(2-fluorophenyl)propyl]amino]pyridazin-3-yl]benzamide is sourced from PubChem (CID 53496351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).