C18H16FN5O2S — CID 5349866
2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 5349866) has the molecular formula C18H16FN5O2S and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 5349866 |
| Molecular Formula | C18H16FN5O2S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | Nc1nnc(CC(=O)N/N=C/c2ccc(OCc3ccccc3F)cc2)s1 |
| InChI | InChI=1S/C18H16FN5O2S/c19-15-4-2-1-3-13(15)11-26-14-7-5-12(6-8-14)10-21-22-16(25)9-17-23-24-18(20)27-17/h1-8,10H,9,11H2,(H2,20,24)(H,22,25)/b21-10+ |
| InChIKey | HSEGWKXTLXRBRZ-UFFVCSGVSA-N |
| XLogP | 2.53 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|