C33H30N2O7S — CID 5350044
benzyl 3-[[(E)-2-benzamido-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoyl]amino]propanoate (PubChem CID 5350044) has the molecular formula C33H30N2O7S and a molecular weight of 598.68 g/mol. Its IUPAC name is benzyl 3-[[(E)-2-benzamido-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoyl]amino]propanoate.
| Compound Name | benzyl 3-[[(E)-2-benzamido-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 5350044 |
| Molecular Formula | C33H30N2O7S |
| Molecular Weight | 598.68 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | benzyl 3-[[(E)-2-benzamido-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enoyl]amino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(/C=C(/NC(=O)c3ccccc3)C(=O)NCCC(=O)OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H30N2O7S/c1-24-12-18-29(19-13-24)43(39,40)42-28-16-14-25(15-17-28)22-30(35-32(37)27-10-6-3-7-11-27)33(38)34-21-20-31(36)41-23-26-8-4-2-5-9-26/h2-19,22H,20-21,23H2,1H3,(H,34,38)(H,35,37)/b30-22+ |
| InChIKey | ULDDPPMVGFXSIM-JBASAIQMSA-N |
| XLogP | 4.78 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.68 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|