C26H28B2O6 — CID 535460
2-diethylboranyloxy-2-(2-diethylboranyloxy-1,3-dioxoinden-2-yl)indene-1,3-dione (PubChem CID 535460) has the molecular formula C26H28B2O6 and a molecular weight of 458.13 g/mol. Its IUPAC name is 2-diethylboranyloxy-2-(2-diethylboranyloxy-1,3-dioxoinden-2-yl)indene-1,3-dione.
| Compound Name | 2-diethylboranyloxy-2-(2-diethylboranyloxy-1,3-dioxoinden-2-yl)indene-1,3-dione |
|---|---|
| PubChem CID | 535460 |
| Molecular Formula | C26H28B2O6 |
| Molecular Weight | 458.13 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 2-diethylboranyloxy-2-(2-diethylboranyloxy-1,3-dioxoinden-2-yl)indene-1,3-dione |
| SMILES | CCB(CC)OC1(C2(OB(CC)CC)C(=O)c3ccccc3C2=O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H28B2O6/c1-5-27(6-2)33-25(21(29)17-13-9-10-14-18(17)22(25)30)26(34-28(7-3)8-4)23(31)19-15-11-12-16-20(19)24(26)32/h9-16H,5-8H2,1-4H3 |
| InChIKey | HMGDEKOWMYOBHM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.13 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|