C9H7N5 — CID 5354905
5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 5354905) has the molecular formula C9H7N5 and a molecular weight of 185.19 g/mol. Its IUPAC name is 5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | 5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 5354905 |
| Molecular Formula | C9H7N5 |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | Nc1nnc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C9H7N5/c10-9-12-8-7(13-14-9)5-3-1-2-4-6(5)11-8/h1-4H,(H3,10,11,12,14) |
| InChIKey | ASGZIQFYJJFISO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |