About (4-amino-1,2,5-oxadiazol-3-yl)-piperidin-1-ylmethanone
(4-amino-1,2,5-oxadiazol-3-yl)-piperidin-1-ylmethanone (PubChem CID 535637) has the molecular formula C8H12N4O2
and a molecular weight of 196.21 g/mol. Its IUPAC name is (4-amino-1,2,5-oxadiazol-3-yl)-piperidin-1-ylmethanone.
Analyze (4-amino-1,2,5-oxadiazol-3-yl)-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-1,2,5-oxadiazol-3-yl)-piperidin-1-ylmethanone?
The IUPAC name of (4-amino-1,2,5-oxadiazol-3-yl)-piperidin-1-ylmethanone (CID 535637) is (4-amino-1,2,5-oxadiazol-3-yl)-piperidin-1-ylmethanone.
What is the SMILES notation for (4-amino-1,2,5-oxadiazol-3-yl)-piperidin-1-ylmethanone?
The canonical SMILES for (4-amino-1,2,5-oxadiazol-3-yl)-piperidin-1-ylmethanone is Nc1nonc1C(=O)N1CCCCC1.
What is the InChIKey of (4-amino-1,2,5-oxadiazol-3-yl)-piperidin-1-ylmethanone?
The InChIKey is XYHTWIYVANKCPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O2/c9-7-6(10-14-11-7)8(13)12-4-2-1-3-5-12/h1-5H2,(H2,9,11).
What are the key properties of (4-amino-1,2,5-oxadiazol-3-yl)-piperidin-1-ylmethanone?
(4-amino-1,2,5-oxadiazol-3-yl)-piperidin-1-ylmethanone has a molecular weight of 196.21 g/mol, XLogP of 0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-1,2,5-oxadiazol-3-yl)-piperidin-1-ylmethanone is sourced from PubChem (CID 535637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).