C6H6O4 — CID 5356793
(2E,4E)-hexa-2,4-dienedioic acid (PubChem CID 5356793) has the molecular formula C6H6O4 and a molecular weight of 142.11 g/mol. Its IUPAC name is (2E,4E)-hexa-2,4-dienedioic acid.
| Compound Name | (2E,4E)-hexa-2,4-dienedioic acid |
|---|---|
| PubChem CID | 5356793 |
| Molecular Formula | C6H6O4 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | (2E,4E)-hexa-2,4-dienedioic acid |
| SMILES | O=C(O)/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C6H6O4/c7-5(8)3-1-2-4-6(9)10/h1-4H,(H,7,8)(H,9,10)/b3-1+,4-2+ |
| InChIKey | TXXHDPDFNKHHGW-ZPUQHVIOSA-N |
| XLogP | 0.27 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|