About hexa-2,4-dienoic acid
hexa-2,4-dienoic acid (PubChem CID 5251) has the molecular formula C6H8O2
and a molecular weight of 112.13 g/mol. Its IUPAC name is hexa-2,4-dienoic acid.
Molecular Properties
| Compound Name | hexa-2,4-dienoic acid |
| PubChem CID | 5251 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | hexa-2,4-dienoic acid |
| SMILES | CC=CC=CC(=O)O |
| InChI | InChI=1S/C6H8O2/c1-2-3-4-5-6(7)8/h2-5H,1H3,(H,7,8) |
| InChIKey | WSWCOQWTEOXDQX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze hexa-2,4-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-2,4-dienoic acid?
The IUPAC name of hexa-2,4-dienoic acid (CID 5251) is hexa-2,4-dienoic acid.
What is the SMILES notation for hexa-2,4-dienoic acid?
The canonical SMILES for hexa-2,4-dienoic acid is CC=CC=CC(=O)O.
What is the InChIKey of hexa-2,4-dienoic acid?
The InChIKey is WSWCOQWTEOXDQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2/c1-2-3-4-5-6(7)8/h2-5H,1H3,(H,7,8).
What are the key properties of hexa-2,4-dienoic acid?
hexa-2,4-dienoic acid has a molecular weight of 112.13 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-2,4-dienoic acid is sourced from PubChem (CID 5251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).