C15H14N2O3 — CID 5358242
(2E)-2-[1-(2,5-dimethoxyphenyl)-3-methyl-5-oxopyrrol-2-ylidene]acetonitrile (PubChem CID 5358242) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is (2E)-2-[1-(2,5-dimethoxyphenyl)-3-methyl-5-oxopyrrol-2-ylidene]acetonitrile.
| Compound Name | (2E)-2-[1-(2,5-dimethoxyphenyl)-3-methyl-5-oxopyrrol-2-ylidene]acetonitrile |
|---|---|
| PubChem CID | 5358242 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (2E)-2-[1-(2,5-dimethoxyphenyl)-3-methyl-5-oxopyrrol-2-ylidene]acetonitrile |
| SMILES | COc1ccc(OC)c(N2C(=O)C=C(C)/C2=C\C#N)c1 |
| InChI | InChI=1S/C15H14N2O3/c1-10-8-15(18)17(12(10)6-7-16)13-9-11(19-2)4-5-14(13)20-3/h4-6,8-9H,1-3H3/b12-6+ |
| InChIKey | FJSRPNDIHBDZNV-WUXMJOGZSA-N |
| XLogP | 2.40 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|