C15H15NO4 — CID 82420706
1-(2,5-dimethoxyphenyl)-6-methyl-4-oxopyridine-3-carbaldehyde (PubChem CID 82420706) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-6-methyl-4-oxopyridine-3-carbaldehyde.
| Compound Name | 1-(2,5-dimethoxyphenyl)-6-methyl-4-oxopyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 82420706 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-6-methyl-4-oxopyridine-3-carbaldehyde |
| SMILES | COc1ccc(OC)c(-n2cc(C=O)c(=O)cc2C)c1 |
| InChI | InChI=1S/C15H15NO4/c1-10-6-14(18)11(9-17)8-16(10)13-7-12(19-2)4-5-15(13)20-3/h4-9H,1-3H3 |
| InChIKey | UUAMZOZVYJYNAT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|