C20H16N2O9S — CID 5358937
methyl 5-[(E)-2-(4-acetamidophenyl)sulfonyl-2-(5-nitrofuran-2-yl)ethenyl]furan-2-carboxylate (PubChem CID 5358937) has the molecular formula C20H16N2O9S and a molecular weight of 460.42 g/mol. Its IUPAC name is methyl 5-[(E)-2-(4-acetamidophenyl)sulfonyl-2-(5-nitrofuran-2-yl)ethenyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(E)-2-(4-acetamidophenyl)sulfonyl-2-(5-nitrofuran-2-yl)ethenyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 5358937 |
| Molecular Formula | C20H16N2O9S |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | methyl 5-[(E)-2-(4-acetamidophenyl)sulfonyl-2-(5-nitrofuran-2-yl)ethenyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(/C=C(\c2ccc([N+](=O)[O-])o2)S(=O)(=O)c2ccc(NC(C)=O)cc2)o1 |
| InChI | InChI=1S/C20H16N2O9S/c1-12(23)21-13-3-6-15(7-4-13)32(27,28)18(16-9-10-19(31-16)22(25)26)11-14-5-8-17(30-14)20(24)29-2/h3-11H,1-2H3,(H,21,23)/b18-11+ |
| InChIKey | JWZVKXBMKRDFNU-WOJGMQOQSA-N |
| XLogP | 3.50 |
| TPSA | 158.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|