C19H13NO7S — CID 171976500
5-[(Z)-2-(benzenesulfonyl)-2-(5-nitrofuran-2-yl)ethenyl]-1,3-benzodioxole (PubChem CID 171976500) has the molecular formula C19H13NO7S and a molecular weight of 399.38 g/mol. Its IUPAC name is 5-[(Z)-2-(benzenesulfonyl)-2-(5-nitrofuran-2-yl)ethenyl]-1,3-benzodioxole.
| Compound Name | 5-[(Z)-2-(benzenesulfonyl)-2-(5-nitrofuran-2-yl)ethenyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 171976500 |
| Molecular Formula | C19H13NO7S |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 5-[(Z)-2-(benzenesulfonyl)-2-(5-nitrofuran-2-yl)ethenyl]-1,3-benzodioxole |
| SMILES | O=[N+]([O-])c1ccc(/C(=C/c2ccc3c(c2)OCO3)S(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C19H13NO7S/c21-20(22)19-9-8-16(27-19)18(28(23,24)14-4-2-1-3-5-14)11-13-6-7-15-17(10-13)26-12-25-15/h1-11H,12H2/b18-11- |
| InChIKey | FSWGHBUSZMDQSP-WQRHYEAKSA-N |
| XLogP | 3.89 |
| TPSA | 108.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|